L-histidine


L-histidine
Links:📏 NIST
CAS:[71-00-1]
Formula:C6H9N3O2; 155.16 g/mol
InChiKey:HNDVDQJCIGZPNO-YFKPBYRVSA-N
SMILES:N[C@@H](Cc1c[nH]cn1)C(O)=O
Molecular structure of L-histidine
Melting point:287 °C
Log10 partition octanol / water:-3.32

Isomers

2-amino-4,6-dimethoxypyrimidine
Molecular structure of 2-amino-4,6-dimethoxypyrimidine
4-amino-2,6-dimethoxypyrimidine
Molecular structure of 4-amino-2,6-dimethoxypyrimidine
6-amino-1,3-dimethylpyrimidine-2,4-dione
Molecular structure of 6-amino-1,3-dimethylpyrimidine-2,4-dione
cupferron
Molecular structure of cupferron
2-cyano-N-methyl-N-(methylcarbamoyl)acetamide
Molecular structure of 2-cyano-N-methyl-N-(methylcarbamoyl)acetamide
ethyl-5-amino-1H-pyrazol-4-carboxylate
Molecular structure of ethyl-5-amino-1H-pyrazol-4-carboxylate
ethyl 3-amino-1H-pyrazole-4-carboxylate
Molecular structure of ethyl 3-amino-1H-pyrazole-4-carboxylate
DL-histidine
Molecular structure of DL-histidine
histidine
Molecular structure of histidine
L-histidine
Molecular structure of L-histidine
2-isopropyl-4-nitroimidazole
Molecular structure of 2-isopropyl-4-nitroimidazole
N-methoxy-N-methyl-1H-imidazole-1-carboxamide
Molecular structure of N-methoxy-N-methyl-1H-imidazole-1-carboxamide