L-lysine


(2S)-2,6-diaminohexanoic acid; L-(+)-lysine; L-lysine; lysine
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[56-87-1]
Formula:C6H14N2O2; 146.19 g/mol
InChiKey:KDXKERNSBIXSRK-YFKPBYRVSA-N
SMILES:NCCCC[C@H](N)C(O)=O
Molecular structure of L-lysine
Melting point:224 °C
Log10 partition octanol / water:-3.05

Isomers

trans-2,5-bis(aminomethyl)-p-dioxane
Molecular structure of trans-2,5-bis(aminomethyl)-p-dioxane
1-Boc-1-methylhydrazine
Molecular structure of 1-Boc-1-methylhydrazine
(2S)-2,5-diamino-2-methylpentanoic acid
Molecular structure of (2S)-2,5-diamino-2-methylpentanoic acid
diisopropylnitramide
Molecular structure of diisopropylnitramide
di-n-propylnitramide
Molecular structure of di-n-propylnitramide
N-hexylnitroamine
Molecular structure of N-hexylnitroamine
D-lysine
Molecular structure of D-lysine
DL-lysine
Molecular structure of DL-lysine
L-lysine
Molecular structure of L-lysine
3-(2,2,2-trimethylhydrazine)propionate
Molecular structure of 3-(2,2,2-trimethylhydrazine)propionate