L-phenylalanine


(2S)-2-amino-3-phenylpropanoic acid; (-)-phenylalanine; (S)-phenylalanine; L-phenylalanine; phenylalanine
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenylalanin); p. 362, 872
CAS:[63-91-2]
Formula:C9H11NO2; 165.19 g/mol
InChiKey:COLNVLDHVKWLRT-QMMMGPOBSA-N
SMILES:N[C@@H](Cc1ccccc1)C(O)=O
Molecular structure of L-phenylalanine
Melting point:283 °C
Log10 partition octanol / water:-1.38

Isomers

2-acetamido-5-methylphenol
Molecular structure of 2-acetamido-5-methylphenol
2-amino-3,5-dimethylbenzoic acid
Molecular structure of 2-amino-3,5-dimethylbenzoic acid
2-aminomethyl-1,4-benzodioxane
Molecular structure of 2-aminomethyl-1,4-benzodioxane
2-amino-3-phenylpropanoic acid
Molecular structure of 2-amino-3-phenylpropanoic acid
3-amino-3-phenylpropanoic acid
Molecular structure of 3-amino-3-phenylpropanoic acid
3-(3-aminophenyl)propionic acid
Molecular structure of 3-(3-aminophenyl)propionic acid
3-(4-aminophenyl)propionic acid
Molecular structure of 3-(4-aminophenyl)propionic acid
cyclohexylidenecyanoacetic acid
Molecular structure of cyclohexylidenecyanoacetic acid
3,4-dihydro-2H-1,5-benzodioxepin-7-amine
Molecular structure of 3,4-dihydro-2H-1,5-benzodioxepin-7-amine
2-(dimethylamino)benzoic acid
Molecular structure of 2-(dimethylamino)benzoic acid
3-dimethylaminobenzoic acid
Molecular structure of 3-dimethylaminobenzoic acid
4-dimethylaminobenzoic acid
Molecular structure of 4-dimethylaminobenzoic acid
3,5-dimethylanthranilic acid
Molecular structure of 3,5-dimethylanthranilic acid
N,N-dimethylsalicylamide
Molecular structure of N,N-dimethylsalicylamide
2-(1,3,-dioxolan-2-yl)-6-methylpyridine
Molecular structure of 2-(1,3,-dioxolan-2-yl)-6-methylpyridine
2-ethoxybenzamide
Molecular structure of 2-ethoxybenzamide
3-ethoxybenzamide
Molecular structure of 3-ethoxybenzamide
4-ethoxybenzamide
Molecular structure of 4-ethoxybenzamide
ethyl 2-aminobenzoate
Molecular structure of ethyl 2-aminobenzoate
ethyl 3-aminobenzoate
Molecular structure of ethyl 3-aminobenzoate
ethyl 4-aminobenzoate
Molecular structure of ethyl 4-aminobenzoate
ethyl 2-methylisonicotinate
Molecular structure of ethyl 2-methylisonicotinate
ethyl 2-methylpyridine-3-carboxylate
Molecular structure of ethyl 2-methylpyridine-3-carboxylate
ethyl 6-methylpyridine-2-carboxylate
Molecular structure of ethyl 6-methylpyridine-2-carboxylate
ethyl N-phenylcarbamate
Molecular structure of ethyl N-phenylcarbamate
ethyl 4-pyridineacetate
Molecular structure of ethyl 4-pyridineacetate
ethyl 2-pyridylacetate
Molecular structure of ethyl 2-pyridylacetate
ethyl 3-pyridylacetate
Molecular structure of ethyl 3-pyridylacetate
N-(2-hydroxy-5-methylphenyl)acetamide
Molecular structure of N-(2-hydroxy-5-methylphenyl)acetamide
N-(4-hydroxy-2-methylphenyl)acetamide
Molecular structure of N-(4-hydroxy-2-methylphenyl)acetamide
N-(4-hydroxy-3-methylphenyl)acetamide
Molecular structure of N-(4-hydroxy-3-methylphenyl)acetamide
N-(4-hydroxyphenyl)-N-methylacetamide
Molecular structure of N-(4-hydroxyphenyl)-N-methylacetamide
2-hydroxy-N-phenyl-propanamide
Molecular structure of 2-hydroxy-N-phenyl-propanamide
isopropyl pyridine-3-carboxylate
Molecular structure of isopropyl pyridine-3-carboxylate
2-methoxyacetanilide
Molecular structure of 2-methoxyacetanilide
3-methoxyacetanilide
Molecular structure of 3-methoxyacetanilide
4'-methoxyacetanilide
Molecular structure of 4'-methoxyacetanilide
4-methoxyacetophenone oxime
Molecular structure of 4-methoxyacetophenone oxime
(E)-N-methoxy-1-(2-methoxyphenyl)methanimine
Molecular structure of (E)-N-methoxy-1-(2-methoxyphenyl)methanimine
N-methoxy-N-methylbenzamide
Molecular structure of N-methoxy-N-methylbenzamide
N-(2-methoxyphenyl)acetamide
Molecular structure of N-(2-methoxyphenyl)acetamide
N-(3-methoxyphenyl)acetamide
Molecular structure of N-(3-methoxyphenyl)acetamide
4-methoxyphenylacetamide
Molecular structure of 4-methoxyphenylacetamide
methyl 3-amino-2-methylbenzoate
Molecular structure of methyl 3-amino-2-methylbenzoate
methyl 3-amino-4-methylbenzoate
Molecular structure of methyl 3-amino-4-methylbenzoate
methyl 2-methylaminobenzoate
Molecular structure of methyl 2-methylaminobenzoate
methyl 4-methylaminobenzoate
Molecular structure of methyl 4-methylaminobenzoate
methyl N-(2-methylphenyl)carbamate
Molecular structure of methyl N-(2-methylphenyl)carbamate
2-methylphenyl N-methylcarbamate
Molecular structure of 2-methylphenyl N-methylcarbamate
3-methylphenyl N-methylcarbamate
Molecular structure of 3-methylphenyl N-methylcarbamate
4-methylphenyl N-methylcarbamate
Molecular structure of 4-methylphenyl N-methylcarbamate
methyl 3-(3-pyridyl)propionate
Molecular structure of methyl 3-(3-pyridyl)propionate
2-nitromesitylene
Molecular structure of 2-nitromesitylene
1-nitro-4-propan-2-ylbenzene
Molecular structure of 1-nitro-4-propan-2-ylbenzene
2-nitropropan-2-ylbenzene
Molecular structure of 2-nitropropan-2-ylbenzene
1-nitro-2-propylbenzene
Molecular structure of 1-nitro-2-propylbenzene
1-nitro-4-propylbenzene
Molecular structure of 1-nitro-4-propylbenzene
D-phenylalanine
Molecular structure of D-phenylalanine
L-phenylalanine
Molecular structure of L-phenylalanine
phenyl N,N-dimethylcarbamate
Molecular structure of phenyl N,N-dimethylcarbamate
propyl pyridine-2-carboxylate
Molecular structure of propyl pyridine-2-carboxylate
propyl pyridine-3-carboxylate
Molecular structure of propyl pyridine-3-carboxylate
propyl pyridine-4-carboxylate
Molecular structure of propyl pyridine-4-carboxylate
1,2,4-trimethyl-5-nitrobenzene
Molecular structure of 1,2,4-trimethyl-5-nitrobenzene
tropicamide
Molecular structure of tropicamide