L-proline


L-proline; (2S)-pyrrolidine-2-carboxylic acid
Links:📏 NIST, 🕷 ChemSpider
CAS:[147-85-3]
Formula:C5H9NO2; 115.13 g/mol
InChiKey:ONIBWKKTOPOVIA-BYPYZUCNSA-N
SMILES:OC(=O)[C@@H]1CCCN1
Molecular structure of L-proline
Density:1.360 g/mL
Molar volume:84.7 mL/mol
Melting point:217 °C
Log10 partition octanol / water:-2.54

Isomers

N-acetyl-N-methylacetamide
Molecular structure of N-acetyl-N-methylacetamide
1-amino-1-cyclobutanecarboxylic acid
Molecular structure of 1-amino-1-cyclobutanecarboxylic acid
2-aminopent-4-enoic acid
Molecular structure of 2-aminopent-4-enoic acid
4-formylmorpholine
Molecular structure of 4-formylmorpholine
N-(hydroxymethyl)-2-methylprop-2-enamide
Molecular structure of N-(hydroxymethyl)-2-methylprop-2-enamide
(R)-(-)-5-(hydroxymethyl)-2-pyrrolidinone
Molecular structure of (R)-(-)-5-(hydroxymethyl)-2-pyrrolidinone
(S)-5-(hydroxymethyl)-2-pyrrolidinone
Molecular structure of (S)-5-(hydroxymethyl)-2-pyrrolidinone
methyl 3-aminocrotonate
Molecular structure of methyl 3-aminocrotonate
3-methyl-1-nitro-1-butene
Molecular structure of 3-methyl-1-nitro-1-butene
3-methyl-2-nitro-2-butene
Molecular structure of 3-methyl-2-nitro-2-butene
nitrocyclopentane
Molecular structure of nitrocyclopentane
2-nitro-2-pentene
Molecular structure of 2-nitro-2-pentene
1,4-oxazepan-5-one
Molecular structure of 1,4-oxazepan-5-one
D-proline
Molecular structure of D-proline
DL-proline
Molecular structure of DL-proline
L-proline
Molecular structure of L-proline
2-(prop-2-enylamino)acetic acid
Molecular structure of 2-(prop-2-enylamino)acetic acid
(S)-(-)-tetrahydrofuran-2-carboxamide
Molecular structure of (S)-(-)-tetrahydrofuran-2-carboxamide