L-threonine


(2S,3R)-2-amino-3-hydroxybutanoic acid; L-threonine
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[72-19-5]
Formula:C4H9NO3; 119.12 g/mol
InChiKey:AYFVYJQAPQTCCC-GBXIJSLDSA-N
SMILES:C[C@@H](O)[C@H](N)C(O)=O
Molecular structure of L-threonine
Melting point:256 °C
Log10 partition octanol / water:-2.94

Isomers

D-allo-threonine
Molecular structure of D-allo-threonine
DL-allothreonine
Molecular structure of DL-allothreonine
L-allo-threonine
Molecular structure of L-allo-threonine
2-(2-aminoethoxy)acetic acid
Molecular structure of 2-(2-aminoethoxy)acetic acid
(2S)-2-amino-4-hydroxybutanoic acid
Molecular structure of (2S)-2-amino-4-hydroxybutanoic acid
2-amino-4-hydroxybutanoic acid
Molecular structure of 2-amino-4-hydroxybutanoic acid
(2S)-4-amino-2-hydroxybutanoic acid
Molecular structure of (2S)-4-amino-2-hydroxybutanoic acid
(S)-(+)-4-amino-3-hydroxybutyric acid
Molecular structure of (S)-(+)-4-amino-3-hydroxybutyric acid
4-amino-3-hydroxybutyric acid
Molecular structure of 4-amino-3-hydroxybutyric acid
3-amino-2-hydroxy-2-methylpropanoic acid
Molecular structure of 3-amino-2-hydroxy-2-methylpropanoic acid
2-amino-3-methoxypropanoic acid
Molecular structure of 2-amino-3-methoxypropanoic acid
2-amino-3-methoxypropanoic acid
Molecular structure of 2-amino-3-methoxypropanoic acid
butan-2-yl nitrate
Molecular structure of butan-2-yl nitrate
butyl nitrate
Molecular structure of butyl nitrate
tert-butyl nitrate
Molecular structure of tert-butyl nitrate
D-homoserine
Molecular structure of D-homoserine
isobutyl nitrate
Molecular structure of isobutyl nitrate
2-methyl-2-nitropropan-1-ol
Molecular structure of 2-methyl-2-nitropropan-1-ol
1-nitrobutan-2-ol
Molecular structure of 1-nitrobutan-2-ol
2-nitrobutan-1-ol
Molecular structure of 2-nitrobutan-1-ol
DL-threonine
Molecular structure of DL-threonine
L-threonine
Molecular structure of L-threonine
threonine
Molecular structure of threonine