L-tryptophan


(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid; (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid; (S)-(-)-tryptophan; L-tryptophan; tryptophan
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
MeSH:Antidepressive Agents, Second-Generation; Central Nervous System Agents; Psychotropic Drugs
CAS:[54-12-6]
Formula:C11H12N2O2; 204.23 g/mol
InChiKey:QIVBCDIJIAJPQS-VIFPVBQESA-N
SMILES:O=C(O)C(N)Cc2c[nH]c1ccccc12
Molecular structure of L-tryptophan
Melting point:293 °C
Log10 partition octanol / water:-1.06

Isomers

(4-cyanophenyl)methyl N,N-dimethylcarbamate
Molecular structure of (4-cyanophenyl)methyl N,N-dimethylcarbamate
5-dimethylamino-2-methylisoindole-1,3-dione
Molecular structure of 5-dimethylamino-2-methylisoindole-1,3-dione
3-ethyl-5-phenylimidazolidine-2,4-dione
Molecular structure of 3-ethyl-5-phenylimidazolidine-2,4-dione
3-ethyl-5-phenylimidazolidine-2,4-dione
Molecular structure of 3-ethyl-5-phenylimidazolidine-2,4-dione
fenozolone
Molecular structure of fenozolone
4-hydroxyantipyrine
Molecular structure of 4-hydroxyantipyrine
idazoxan
Molecular structure of idazoxan
1-isopropyl-2,3(1~H,4~H)-quinoxalinedione
Molecular structure of 1-isopropyl-2,3(1H,4H)-quinoxalinedione
3-methoxy-6,7-dimethyl-2(1~H)-quinoxalinone
Molecular structure of 3-methoxy-6,7-dimethyl-2(1H)-quinoxalinone
2-[(3-methylphenyl)methylidene]propanediamide
Molecular structure of 2-[(3-methylphenyl)methylidene]propanediamide
nirvanol
Molecular structure of nirvanol
5-oxo-N-phenyl-2-pyrrolidinecarboxamide
Molecular structure of 5-oxo-N-phenyl-2-pyrrolidinecarboxamide
3-phenylazo-2,4-pentanedione
Molecular structure of 3-phenylazo-2,4-pentanedione
thozalinone
Molecular structure of thozalinone
1,6,7-trimethyl-2,3(1~H,4~H)-quinoxalinedione
Molecular structure of 1,6,7-trimethyl-2,3(1H,4H)-quinoxalinedione
D-tryptophan
Molecular structure of D-tryptophan
DL-tryptophan
Molecular structure of DL-tryptophan
L-tryptophan
Molecular structure of L-tryptophan