PCB-17


2,4-dichloro-1-(2-chlorophenyl)benzene; PCB-17; 2,2',4-PCB; 2,2',4-trichlorobiphenyl
Links:📏 NIST, 🕷 ChemSpider
CAS:[37680-66-3]
Formula:C12H7Cl3; 257.55 g/mol
InChiKey:YKKYCYQDUUXNLN-UHFFFAOYSA-N
SMILES:Clc1ccc(c(Cl)c1)c2ccccc2Cl
Molecular structure of 2,2',4-trichlorobiphenyl
Log10 partition octanol / water:5.76

Isomers

2,2',3-trichlorobiphenyl
Molecular structure of 2,2',3-trichlorobiphenyl
2,2',4-trichlorobiphenyl
Molecular structure of 2,2',4-trichlorobiphenyl
2,2',5-trichlorobiphenyl
Molecular structure of 2,2',5-trichlorobiphenyl
2,2',6-trichlorobiphenyl
Molecular structure of 2,2',6-trichlorobiphenyl
2,3,3'-trichlorobiphenyl
Molecular structure of 2,3,3'-trichlorobiphenyl
2,3,4-trichlorobiphenyl
Molecular structure of 2,3,4-trichlorobiphenyl
2,3,4'-trichlorobiphenyl
Molecular structure of 2,3,4'-trichlorobiphenyl
2,3,6-trichlorobiphenyl
Molecular structure of 2,3,6-trichlorobiphenyl
2,3',5-trichlorobiphenyl
Molecular structure of 2,3',5-trichlorobiphenyl
2,3',6-trichlorobiphenyl
Molecular structure of 2,3',6-trichlorobiphenyl
2,4,4'-trichlorobiphenyl
Molecular structure of 2,4,4'-trichlorobiphenyl
2,4,5-trichlorobiphenyl
Molecular structure of 2,4,5-trichlorobiphenyl
2,4,6-trichlorobiphenyl
Molecular structure of 2,4,6-trichlorobiphenyl
2,4',5-trichlorobiphenyl
Molecular structure of 2,4',5-trichlorobiphenyl
2,4',6-trichlorobiphenyl
Molecular structure of 2,4',6-trichlorobiphenyl
2',3,4-trichlorobiphenyl
Molecular structure of 2',3,4-trichlorobiphenyl
2',3,5-trichlorobiphenyl
Molecular structure of 2',3,5-trichlorobiphenyl
3,3',5-trichlorobiphenyl
Molecular structure of 3,3',5-trichlorobiphenyl
3,4,4'-trichlorobiphenyl
Molecular structure of 3,4,4'-trichlorobiphenyl