arginine


(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid; (S)-2-amino-5-guanidinopentanoic acid; arginine; L-(+)-arginine; L-arginine
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[74-79-3]
Formula:C6H14N4O2; 174.20 g/mol
InChiKey:ODKSFYDXXFIFQN-BYPYZUCNSA-N
SMILES:N[C@@H](CCCNC(N)=N)C(O)=O
Molecular structure of arginine
Melting point:238 °C
Boiling point:368 °C
Log10 partition octanol / water:-4.20

Isomers

adipic acid dihydrazide
Molecular structure of adipic acid dihydrazide
adipic dihydrazide
Molecular structure of adipic dihydrazide
arginine
Molecular structure of arginine
D-arginine
Molecular structure of D-arginine
DL-arginine
Molecular structure of DL-arginine
[1-(carbamoylamino)-2-methylpropyl]urea
Molecular structure of [1-(carbamoylamino)-2-methylpropyl]urea