asparagine


asparagine; L-asparagine; asparagine anhydrous; (2S)-2,4-diamino-4-oxobutanoic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Asparagin); p. 849, 850,
📖Org. Chem., v. Richter, 1. Vol (Asparagine); p. 554, 559, 567
CAS:[70-47-3]
Formula:C4H8N2O3; 132.12 g/mol
InChiKey:DCXYFEDJOCDNAF-REOHCLBHSA-N
SMILES:N[C@@H](CC(N)=O)C(O)=O
Molecular structure of asparagine
Density:1.543 g/mL
Molar volume:85.6 mL/mol
Melting point:235 °C
Boiling point:438 °C
Log10 partition octanol / water:-3.82

Isomers

asparagine
Molecular structure of asparagine
(S)-2-(carbamoylamino)propanoic acid
Molecular structure of (S)-2-(carbamoylamino)propanoic acid
2-(carbamoylamino)propanoic acid
Molecular structure of 2-(carbamoylamino)propanoic acid
ethyl N-carbamoylcarbamate
Molecular structure of ethyl N-carbamoylcarbamate
glycolylglycineamide
Molecular structure of glycolylglycineamide
glycylglycine
Molecular structure of glycylglycine
methyl(acetoxymethyl)nitrosamine
Molecular structure of methyl(acetoxymethyl)nitrosamine
methylazoxymethyl acetate
Molecular structure of methylazoxymethyl acetate
N-nitromorpholine
Molecular structure of N-nitromorpholine
N-nitrosomethylurethane
Molecular structure of N-nitrosomethylurethane
3-ureidopropanoic acid
Molecular structure of 3-ureidopropanoic acid