benzyl benzoate


benzoic acid benzyl ester; benzyl benzoate
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Benzylbenzoat); p. 543
MeSH:Insecticides; Pesticides
CAS:[120-51-4]
Formula:C14H12O2; 212.25 g/mol
InChiKey:SESFRYSPDFLNCH-UHFFFAOYSA-N
SMILES:O=C(OCc1ccccc1)c2ccccc2
Molecular structure of benzyl benzoate
Use:confectionery flavor; perfume fixative
Density:1.114 g/mL
Molar volume:190.5 mL/mol
Refractive index:1.504
Molecular refractive power:56.42 mL/mol
Dielectric constant:4.90
Dipole moment:2.06 D
Melting point:21 °C
Boiling point:323 °C
Log10 partition octanol / water:3.97
Hansen solubility parameter:δd: 9.8 (cal/mL)½   δp: 2.5 (cal/mL)½   δh: 2.5 (cal/mL)½

Isomers

2-acetoxybiphenyl
Molecular structure of 2-acetoxybiphenyl
3-acetoxybiphenyl
Molecular structure of 3-acetoxybiphenyl
4-acetoxybiphenyl
Molecular structure of 4-acetoxybiphenyl
benzoin
Molecular structure of benzoin
7-benzoyloxynorbornadiene
Molecular structure of 7-benzoyloxynorbornadiene
benzyl benzoate
Molecular structure of benzyl benzoate
2-benzyloxybenzaldehyde
Molecular structure of 2-benzyloxybenzaldehyde
3-benzyloxybenzaldehyde
Molecular structure of 3-benzyloxybenzaldehyde
4-benzyloxybenzaldehyde
Molecular structure of 4-benzyloxybenzaldehyde
2-biphenylacetic acid
Molecular structure of 2-biphenylacetic acid
4-biphenylacetic acid
Molecular structure of 4-biphenylacetic acid
1,5-diacetylnaphthalene
Molecular structure of 1,5-diacetylnaphthalene
3,3-dimethyl-naphtho[2,3-c]furan-1(3~H)-one
Molecular structure of 3,3-dimethyl-naphtho[2,3-c]furan-1(3H)-one
diphenylacetic acid
Molecular structure of diphenylacetic acid
(2R)-2-hydroxy-1,2-di(phenyl)ethanone
Molecular structure of (2R)-2-hydroxy-1,2-di(phenyl)ethanone
(2S)-2-hydroxy-1,2-di(phenyl)ethanone
Molecular structure of (2S)-2-hydroxy-1,2-di(phenyl)ethanone
(2-hydroxy-5-methylphenyl)-phenylmethanone
Molecular structure of (2-hydroxy-5-methylphenyl)-phenylmethanone
2-methoxybenzophenone
Molecular structure of 2-methoxybenzophenone
4-(4-methoxyphenyl)benzaldehyde
Molecular structure of 4-(4-methoxyphenyl)benzaldehyde
(4-methoxyphenyl)-phenylmethanone
Molecular structure of (4-methoxyphenyl)-phenylmethanone
4-methyl-3H-benzo[g]chromen-3-one
Molecular structure of 4-methyl-3H-benzo[g]chromen-3-one
4-methyl-3H-benzo[h]chromen-3-one
Molecular structure of 4-methyl-3H-benzo[h]chromen-3-one
methyl biphenyl-4-carboxylate
Molecular structure of methyl biphenyl-4-carboxylate
4'-methyl-2-biphenylcarboxylic acid
Molecular structure of 4'-methyl-2-biphenylcarboxylic acid
2-(4-methylphenoxy)benzaldehyde
Molecular structure of 2-(4-methylphenoxy)benzaldehyde
4-(4-methylphenoxy)benzaldehyde
Molecular structure of 4-(4-methylphenoxy)benzaldehyde
2-methylphenyl benzoate
Molecular structure of 2-methylphenyl benzoate
3-methylphenyl benzoate
Molecular structure of 3-methylphenyl benzoate
4-methylphenyl benzoate
Molecular structure of 4-methylphenyl benzoate
5-naphthalen-2-yloxolan-2-one
Molecular structure of 5-naphthalen-2-yloxolan-2-one
1-(2-naphthyl)butane-1,3-dione
Molecular structure of 1-(2-naphthyl)butane-1,3-dione
1-naphthyl methacrylate
Molecular structure of 1-naphthyl methacrylate
4'-phenoxyacetophenone
Molecular structure of 4'-phenoxyacetophenone
2-(phenylmethyl)benzoic acid
Molecular structure of 2-(phenylmethyl)benzoic acid
4-(phenylmethyl)benzoic acid
Molecular structure of 4-(phenylmethyl)benzoic acid
pinosylvin
Molecular structure of pinosylvin