benzyl butyl phthalate


BBP; benzyl butyl phthalate; benzyl n-butyl phthalate; butyl benzyl phthalate; butyl phenylmethyl 1,2-benzenedicarboxylate; O1-butyl O2-(phenylmethyl) benzene-1,2-dicarboxylate
Links:📏 NIST, 🕷 ChemSpider
MeSH:Noxae
CAS RN:[85-68-7]
Formula:C19H20O4; 312.37 g/mol
InChiKey:IRIAEXORFWYRCZ-UHFFFAOYSA-N
SMILES:CCCCOC(=O)c1ccccc1C(=O)OCc2ccccc2
Molecular structure of benzyl butyl phthalate
Density:1.100 g/mL
Molar volume:284.0 mL/mol
Refractive index:1.540
Molecular refractive power:89.10 mL/mol
Melting point:230 °C
Boiling point:370 °C
Log10 partition octanol / water:4.73
Hansen solubility parameter:δd: 9.3 (cal/mL)½   δp: 5.5 (cal/mL)½   δh: 1.5 (cal/mL)½

Isomers

benzyl butyl phthalate
Molecular structure of benzyl butyl phthalate
bisphenol α diacetate
Molecular structure of bisphenol a diacetate
2,2-dimethylpropane-1,3-diyl dibenzoate
Molecular structure of 2,2-dimethylpropane-1,3-diyl dibenzoate
2,2-diphenylheptanedioic acid
Molecular structure of 2,2-diphenylheptanedioic acid