cystine


(2R)-2-amino-3-[(2R)-2-amino-3-hydroxy-3-oxopropyl]disulfanylpropanoic acid; cystine; L-cystine
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Cystin); p. 162, 365, 995,
📖Org. Chem., v. Richter, 1. Vol (Cystine); p. 390, 540, 541, 667
CAS:[56-89-3]
Formula:C6H12N2O4S2; 240.30 g/mol
InChiKey:LEVWYRKDKASIDU-IMJSIDKUSA-N
SMILES:N[C@@H](CSSC[C@H](N)C(O)=O)C(O)=O
Molecular structure of cystine
Density:1.677 g/mL
Molar volume:143.3 mL/mol
Melting point:261 °C
Log10 partition octanol / water:-5.08

Isomers

cystine
Molecular structure of cystine
D-cystine
Molecular structure of D-cystine
DL-cystine
Molecular structure of DL-cystine