dibutyl decanedioate


butyl sebacate; dibutyl decanedioate; di-n-butyl sebacate; dibutyl sebacate; sebacic acid dibutyl ester
Links:📏 NIST, 📖 PubMed
CAS RN:[109-43-3]
Formula:C18H34O4; 314.47 g/mol
InChiKey:PYGXAGIECVVIOZ-UHFFFAOYSA-N
SMILES:CCCCOC(=O)CCCCCCCCC(=O)OCCCC
Molecular structure of dibutyl decanedioate
Use:anti-foaming agents; cosmetics; perfume fixative; plasticizer for many resins
Density:0.941 g/mL
Molar volume:334.2 mL/mol
Refractive index:1.443
Molecular refractive power:88.55 mL/mol
Dielectric constant:4.54
Dipole moment:2.64 D
Melting point:-10 °C
Boiling point:349 °C

Isomers

bis(2-ethylbutyl) hexanedioate
Molecular structure of bis(2-ethylbutyl) hexanedioate
dibutyl decanedioate
Molecular structure of dibutyl decanedioate
diethyl tetradecandioate
Molecular structure of diethyl tetradecandioate
dihexyl hexanedioate
Molecular structure of dihexyl hexanedioate
1,2-ethanediol dicaprylate
Molecular structure of 1,2-ethanediol dicaprylate
octadecandioic acid
Molecular structure of octadecandioic acid