dibutyl phthalate


butyl phthalate; n-butyl phthalate; DBP; dibutyl 1,2-benzenedicarboxylate; dibutyl benzene-1,2-dicarboxylate; di-n-butyl o-phthalate; di-n-butyl phthalate; dibutyl phthalate; phthalic acid dibutyl ester
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
MeSH:Plasticizers
CAS RN:[84-74-2]
Formula:C16H22O4; 278.35 g/mol
InChiKey:DOIRQSBPFJWKBE-UHFFFAOYSA-N
SMILES:CCCCOC(=O)c1ccccc1C(=O)OCCCC
Molecular structure of dibutyl phthalate
Density:1.043 g/mL
Molar volume:266.9 mL/mol
Refractive index:1.493
Molecular refractive power:77.56 mL/mol
Dielectric constant:6.44
Dipole moment:2.83 D
Melting point:-35 °C
Boiling point:340 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:5.15
Dimroth ET:39.5
Hildebrant solubility parameter (δ):9.2

Isomers

α,a,α',α'-tetramethyl-1,3-benzenedipropionic acid
Molecular structure of a,a,a',a'-tetramethyl-1,3-benzenedipropionic acid
bis(2-methylpropyl) benzene-1,2-dicarboxylate
Molecular structure of bis(2-methylpropyl) benzene-1,2-dicarboxylate
butyl isobutyl phthalate
Molecular structure of butyl isobutyl phthalate
dibutyl benzene-1,3-dicarboxylate
Molecular structure of dibutyl benzene-1,3-dicarboxylate
di(tert-butyl) phthalate
Molecular structure of di(tert-butyl) phthalate
dibutyl phthalate
Molecular structure of dibutyl phthalate
dibutyl terephthalate
Molecular structure of dibutyl terephthalate
ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
Molecular structure of ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
2-(2-ethylhexoxycarbonyl)benzoic acid
Molecular structure of 2-(2-ethylhexoxycarbonyl)benzoic acid