diethyl DL-tartrate


diethyl racemate; diethyl (2R,3R)-rel-2,3-dihydroxybutanedioate; diethyl dl-tartarate; diethyl DL-tartrate; ethyl dl-tartrate; dl-tartaric acid diethyl ester; dl-tartaric acid ethyl ester
Links:📏 NIST
CAS RN:[57968-71-5]
Formula:C8H14O6; 206.20 g/mol
InChiKey:YSAVZVORKRDODB-PHDIDXHHSA-N
SMILES:CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC
Molecular structure of diethyl DL-tartrate
Density:1.203 g/mL
Molar volume:171.4 mL/mol
Refractive index:1.447
Molecular refractive power:45.80 mL/mol
Dielectric constant:4.50
Melting point:18 °C
Boiling point:280 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

diethyl (2R,3R)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2R,3R)-2,3-dihydroxybutanedioate
diethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2S,3S)-2,3-dihydroxybutanedioate
diethyl (R,S)-tartarate
Molecular structure of diethyl (R,S)-tartarate
diethyl DL-tartrate
Molecular structure of diethyl DL-tartrate
diethyl (R*,R*)-tartrate
Molecular structure of diethyl (R*,R*)-tartrate
diisopropyl peroxydicarbonate
Molecular structure of diisopropyl peroxydicarbonate
dimethyl (R*,R*)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R*,R*)-2,3-dimethoxysuccinate
dimethyl (R,S)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R,S)-2,3-dimethoxysuccinate
4,6-O-ethylidene-α-D-glucose
Molecular structure of 4,6-O-ethylidene-a-D-glucose