dimethylpropanedioic acid


dimethylmalonic acid; 2,2-dimethylmalonic acid; dimethylpropanedioic acid; 2,2-dimethylpropanedioic acid
Links:📖 PubMed
CAS RN:[595-46-0]
Formula:C5H8O4; 132.12 g/mol
InChiKey:OREAFAJWWJHCOT-UHFFFAOYSA-N
SMILES:CC(C)(C(O)=O)C(O)=O
Molecular structure of dimethylpropanedioic acid
Melting point:192 °C
Log10 partition octanol / water:0.39

Isomers

2-acetoxypropanoic acid
Molecular structure of 2-acetoxypropanoic acid
dimethyl propanedioate
Molecular structure of dimethyl propanedioate
dimethylpropanedioic acid
Molecular structure of dimethylpropanedioic acid
ethyl hydrogen malonate
Molecular structure of ethyl hydrogen malonate
ethylmalonic acid
Molecular structure of ethylmalonic acid
ethyl methyl oxalate
Molecular structure of ethyl methyl oxalate
hydrogen methyl butanedioate
Molecular structure of hydrogen methyl butanedioate
methylbutanedioic acid
Molecular structure of methylbutanedioic acid
methylene diacetate
Molecular structure of methylene diacetate
(R)-(+)-methylsuccinic acid
Molecular structure of (R)-(+)-methylsuccinic acid
pentanedioic acid
Molecular structure of pentanedioic acid