hypoxanthine


3,7-dihydropurin-6-one; hypoxanthine
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS:[68-94-0]
Formula:C5H4N4O; 136.11 g/mol
InChiKey:FDGQSTZJBFJUBT-UHFFFAOYSA-N
SMILES:O=C1NC=Nc2nc[nH]c12
Molecular structure of hypoxanthine
Melting point:300 °C
Log10 partition octanol / water:-1.11

Isomers

allopurinol
Molecular structure of allopurinol
1,3-dihydro-2H-purin-2-one
Molecular structure of 1,3-dihydro-2H-purin-2-one
8-hydroxypurine
Molecular structure of 8-hydroxypurine
hypoxanthine
Molecular structure of hypoxanthine