ornithine


(2S)-2,5-diaminopentanoic acid; (S)-2,5-diaminopentanoic acid; (+)-2,5-diaminovaleric acid; L-(+)-ornithine; L-ornithine; ornithine
Links:⚗️ ChemSynthesis
CAS:[128551-39-3]
Formula:C5H12N2O2; 132.16 g/mol
InChiKey:AHLPHDHHMVZTML-BYPYZUCNSA-N
SMILES:NCCC[C@H](N)C(O)=O
Molecular structure of ornithine
Melting point:140 °C
Log10 partition octanol / water:-4.41

Isomers

tert-butyl carbazate
Molecular structure of tert-butyl carbazate
1-tert-butyl-3-hydroxyurea
Molecular structure of 1-tert-butyl-3-hydroxyurea
N-butyl-N-methylnitroamine
Molecular structure of N-butyl-N-methylnitroamine
1-hydroxy-3-butylurea
Molecular structure of 1-hydroxy-3-butylurea
3-[(2-hydroxyethyl)amino]propanamide
Molecular structure of 3-[(2-hydroxyethyl)amino]propanamide
N-(2-methylpropyl)-N-methylnitroamine
Molecular structure of N-(2-methylpropyl)-N-methylnitroamine
ornithine
Molecular structure of ornithine