trihexylamine


N,N-dihexylhexan-1-amine; tri-n-hexylamine; trihexylamine
CAS:[102-86-3]
Formula:C18H39N; 269.51 g/mol
InChiKey:DIAIBWNEUYXDNL-UHFFFAOYSA-N
SMILES:CCCCCCN(CCCCCC)CCCCCC
Molecular structure of trihexylamine
Density:0.798 g/mL
Molar volume:337.7 mL/mol
Refractive index:1.442
Molecular refractive power:89.27 mL/mol
Boiling point:260 °C

Isomers

N,N-dimethylhexadecylamine
Molecular structure of N,N-dimethylhexadecylamine
N-ethylhexadecan-1-amine
Molecular structure of N-ethylhexadecan-1-amine
1-octadecylamine
Molecular structure of 1-octadecylamine
trihexylamine
Molecular structure of trihexylamine