trioctyl phosphate


TOP; trioctyl phosphate
Links:🕷 ChemSpider, 📖 PubMed
CAS:[1806-54-8]
Formula:C24H51O4P; 434.64 g/mol
InChiKey:WVPGXJOLGGFBCR-UHFFFAOYSA-N
SMILES:CCCCCCCCO[P](=O)(OCCCCCCCC)OCCCCCCCC
Molecular structure of trioctyl phosphate
Density:0.930 g/mL
Molar volume:467.4 mL/mol
Refractive index:1.441
Molecular refractive power:123.42 mL/mol
Melting point:-74 °C
Hansen solubility parameter:δd: 8.0 (cal/mL)½   δp: 1.0 (cal/mL)½   δh: 2.5 (cal/mL)½

Isomers

didodecyl hydrogen phosphate
Molecular structure of didodecyl hydrogen phosphate
trioctyl phosphate
Molecular structure of trioctyl phosphate