trioctylamine


N,N-dioctyloctan-1-amine; tri(n-octyl)amine; tri-n-octylamine; trioctylamine
CAS:[1116-76-3]
Formula:C24H51N; 353.68 g/mol
InChiKey:XTAZYLNFDRKIHJ-UHFFFAOYSA-N
SMILES:CCCCCCCCN(CCCCCCCC)CCCCCCCC
Molecular structure of tri-n-octylamine
Density:0.810 g/mL
Molar volume:436.6 mL/mol
Refractive index:1.449
Molecular refractive power:117.00 mL/mol
Melting point:-39 °C
Boiling point:366 °C

Isomers

didodecylamine
Molecular structure of didodecylamine
tri-n-octylamine
Molecular structure of tri-n-octylamine
tris(6-methylheptyl)amine
Molecular structure of tris(6-methylheptyl)amine