tripentylamine


N,N-dipentylpentan-1-amine; tri-n-amylamine; triamylamine; tripentylamine
CAS:[621-77-2]
Formula:C15H33N; 227.43 g/mol
InChiKey:OOHAUGDGCWURIT-UHFFFAOYSA-N
SMILES:CCCCCN(CCCCC)CCCCC
Molecular structure of tripentylamine
Density:0.791 g/mL
Molar volume:287.5 mL/mol
Refractive index:1.437
Molecular refractive power:75.33 mL/mol
Boiling point:257 °C
Surface tension:25.80 dyn/cm

Isomers

N,N-dimethyltridecylamine
Molecular structure of N,N-dimethyltridecylamine
N-heptyloctan-1-amine
Molecular structure of N-heptyloctan-1-amine
pentadecylamine
Molecular structure of pentadecylamine
tripentylamine
Molecular structure of tripentylamine
tris(3-methylbutyl)amine
Molecular structure of tris(3-methylbutyl)amine