(1E)-1-propene-1,2,3-tricarboxylic acid


trans-aconitic acid; (1E)-1-propene-1,2,3-tricarboxylic acid; (E)-prop-1-ene-1,2,3-tricarboxylic acid
Links:📖 PubMed
CAS:[4023-65-8]
Formula:C6H6O6; 174.11 g/mol
InChiKey:GTZCVFVGUGFEME-HNQUOIGGSA-N
SMILES:OC(=O)CC(=C/C(O)=O)C(O)=O
Molecular structure of (1E)-1-propene-1,2,3-tricarboxylic acid
Melting point:190 °C

Isomers

aconitic acid
Molecular structure of aconitic acid
dehydroascorbic acid
Molecular structure of dehydroascorbic acid
(1E)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1E)-1-propene-1,2,3-tricarboxylic acid
(1Z)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1Z)-1-propene-1,2,3-tricarboxylic acid