(E)-3-(3,4-dichlorophenyl)prop-2-enoic acid


3,4-dichlorocinnamic acid; (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid
CAS:[1202-39-7]
Formula:C9H6Cl2O2; 217.05 g/mol
InChiKey:RRLUFPHCTSFKNR-DUXPYHPUSA-N
SMILES:OC(=O)/C=C/c1ccc(Cl)c(Cl)c1
Molecular structure of (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid
Melting point:219 °C

Isomers

(E)-2,3-dichloro-3-phenylprop-2-enoic acid
Molecular structure of (E)-2,3-dichloro-3-phenylprop-2-enoic acid
(Z)-2,3-dichloro-3-phenylprop-2-enoic acid
Molecular structure of (Z)-2,3-dichloro-3-phenylprop-2-enoic acid
(E)-3-(2,4-dichlorophenyl)prop-2-enoic acid
Molecular structure of (E)-3-(2,4-dichlorophenyl)prop-2-enoic acid
(E)-3-(3,4-dichlorophenyl)prop-2-enoic acid
Molecular structure of (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid