1,2,3-trinitrobenzene


vic-trinitrobenzene; 1,2,3-trinitrobenzene
CAS:[603-13-4]
Formula:C6H3N3O6; 213.11 g/mol
InChiKey:ONOWMDPHGJEBAZ-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cccc(c1[N+]([O-])=O)[N+]([O-])=O
Molecular structure of 1,2,3-trinitrobenzene
Melting point:128 °C

Isomers

1,2,3-trinitrobenzene
Molecular structure of 1,2,3-trinitrobenzene
1,2,4-trinitrobenzene
Molecular structure of 1,2,4-trinitrobenzene
1,3,5-trinitrobenzene
Molecular structure of 1,3,5-trinitrobenzene