1,3-diethyl 2-[(3-propoxyphenyl)methylidene]propanedioate


1,3-diethyl 2-[(3-propoxyphenyl)methylidene]propanedioate; 3-propoxybenzaldiethylmalonate
CAS:[15725-38-9]
Formula:C17H22O5; 306.36 g/mol
InChiKey:HVSIACXUKGZNHH-UHFFFAOYSA-N
SMILES:CCCOc1cccc(c1)C=C(C(=O)OCC)C(=O)OCC
Molecular structure of 1,3-diethyl 2-[(3-propoxyphenyl)methylidene]propanedioate
Log10 partition octanol / water:4.00

Isomers

1,3-diethyl 2-[(3-propoxyphenyl)methylidene]propanedioate
Molecular structure of 1,3-diethyl 2-[(3-propoxyphenyl)methylidene]propanedioate
ethyl 2-[2-(4-methoxyphenyl)-5-oxotetrahydrofuran-2-yl]-2-methylpropanoate
Molecular structure of ethyl 2-[2-(4-methoxyphenyl)-5-oxotetrahydrofuran-2-yl]-2-methylpropanoate
tenulin
Molecular structure of tenulin
(1,5,8α-trimethyl-2,8-dioxo-3α,4,5,5α,9,9α-hexahydro-1H-azuleno[6,5-β]furan-9-yl) acetate
Molecular structure of (1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl) acetate