2-(benzylmethylamino)-4'-hydroxy-3'-methoxyacetophenone hydrochloride


2-(benzylmethylamino)-4'-hydroxy-3'-methoxyacetophenone hydrochloride
CAS:[206752-44-5]
Formula:C17H20ClNO3; 321.80 g/mol
InChiKey:IBOBACYVCYECOH-UHFFFAOYSA-N
SMILES:Cl.COc1cc(ccc1O)C(=O)CNCCc2ccccc2
Molecular structure of 2-(benzylmethylamino)-4'-hydroxy-3'-methoxyacetophenone hydrochloride
Melting point:195 °C

Isomers

apomorphine hydrochloride hemihydrate
Molecular structure of apomorphine hydrochloride hemihydrate
2-(benzylmethylamino)-4'-hydroxy-3'-methoxyacetophenone hydrochloride
Molecular structure of 2-(benzylmethylamino)-4'-hydroxy-3'-methoxyacetophenone hydrochloride
morphine hydrochloride
Molecular structure of morphine hydrochloride