3,5-dimethylbenzoic acid


1,3-dimethyl-5-benzoic acid; 3,5-dimethylbenzoic acid; mesitylenic acid; sym-m-xylylic acid
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Mesityls√§ure); p. 12,
📖Houben-Weyl, 2. Band (Mesitylens√§ure); p. 980
CAS:[499-06-9]
Formula:C9H10O2; 150.18 g/mol
InChiKey:UMVOQQDNEYOJOK-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(c1)C(O)=O
Molecular structure of 3,5-dimethylbenzoic acid
Melting point:170 °C
Boiling point:221 °C

Isomers

1-acetoxy-3-methylbenzene
Molecular structure of 1-acetoxy-3-methylbenzene
benzyl acetate
Molecular structure of benzyl acetate
4-chromanol
Molecular structure of 4-chromanol
3,4-dihydro-2H-1,5-benzodioxepin
Molecular structure of 3,4-dihydro-2H-1,5-benzodioxepin
(2,3-dihydrobenzofuran-2-yl)methanol
Molecular structure of (2,3-dihydrobenzofuran-2-yl)methanol
2,3-dimethylbenzoic acid
Molecular structure of 2,3-dimethylbenzoic acid
2,4-dimethylbenzoic acid
Molecular structure of 2,4-dimethylbenzoic acid
2,5-dimethylbenzoic acid
Molecular structure of 2,5-dimethylbenzoic acid
2,6-dimethylbenzoic acid
Molecular structure of 2,6-dimethylbenzoic acid
3,4-dimethylbenzoic acid
Molecular structure of 3,4-dimethylbenzoic acid
3,5-dimethylbenzoic acid
Molecular structure of 3,5-dimethylbenzoic acid
2-ethoxybenzaldehyde
Molecular structure of 2-ethoxybenzaldehyde
3-ethoxybenzaldehyde
Molecular structure of 3-ethoxybenzaldehyde
4-ethoxybenzaldehyde
Molecular structure of 4-ethoxybenzaldehyde
ethyl benzoate
Molecular structure of ethyl benzoate
2-ethylbenzoic acid
Molecular structure of 2-ethylbenzoic acid
3-ethylbenzoic acid
Molecular structure of 3-ethylbenzoic acid
4-ethylbenzoic acid
Molecular structure of 4-ethylbenzoic acid
4-hydroxy-3,5-dimethylbenzaldehyde
Molecular structure of 4-hydroxy-3,5-dimethylbenzaldehyde
2-hydroxy-3-methylacetophenone
Molecular structure of 2-hydroxy-3-methylacetophenone
2-hydroxy-5-methylacetophenone
Molecular structure of 2-hydroxy-5-methylacetophenone
2'-hydroxy-4'-methylacetophenone
Molecular structure of 2'-hydroxy-4'-methylacetophenone
2'-hydroxy-5'-methylacetophenone
Molecular structure of 2'-hydroxy-5'-methylacetophenone
4-hydroxy-2-methylacetophenone
Molecular structure of 4-hydroxy-2-methylacetophenone
4-hydroxy-3-methylacetophenone
Molecular structure of 4-hydroxy-3-methylacetophenone
1-(2-hydroxy-4-methylphenyl)ethanone
Molecular structure of 1-(2-hydroxy-4-methylphenyl)ethanone
1-[4-(hydroxymethyl)phenyl]ethanone
Molecular structure of 1-[4-(hydroxymethyl)phenyl]ethanone
1-(4-hydroxy-2-methylphenyl)ethanone
Molecular structure of 1-(4-hydroxy-2-methylphenyl)ethanone
1-(4-hydroxy-3-methylphenyl)ethanone
Molecular structure of 1-(4-hydroxy-3-methylphenyl)ethanone
1-hydroxy-1-phenylacetone
Molecular structure of 1-hydroxy-1-phenylacetone
1-(2-hydroxyphenyl)propan-1-one
Molecular structure of 1-(2-hydroxyphenyl)propan-1-one
2-hydroxy-1-phenyl-1-propanone
Molecular structure of 2-hydroxy-1-phenyl-1-propanone
4-[(E)-3-hydroxyprop-1-enyl]phenol
Molecular structure of 4-[(E)-3-hydroxyprop-1-enyl]phenol
4-hydroxypropiophenone
Molecular structure of 4-hydroxypropiophenone
4'-methoxyacetophenone
Molecular structure of 4'-methoxyacetophenone
3-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-ol
Molecular structure of 3-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-ol
2-methoxy-4-methylbenzaldehyde
Molecular structure of 2-methoxy-4-methylbenzaldehyde
4-methoxy-2-methylbenzaldehyde
Molecular structure of 4-methoxy-2-methylbenzaldehyde
4-methoxy-3-methylbenzaldehyde
Molecular structure of 4-methoxy-3-methylbenzaldehyde
1-(2-methoxyphenyl)ethanone
Molecular structure of 1-(2-methoxyphenyl)ethanone
1-(3-methoxyphenyl)ethanone
Molecular structure of 1-(3-methoxyphenyl)ethanone
2-methoxy-1-phenylethanone
Molecular structure of 2-methoxy-1-phenylethanone
2-methoxy-4-vinylphenol
Molecular structure of 2-methoxy-4-vinylphenol
methyl 2-methylbenzoate
Molecular structure of methyl 2-methylbenzoate
methyl 3-methylbenzoate
Molecular structure of methyl 3-methylbenzoate
methyl 4-methylbenzoate
Molecular structure of methyl 4-methylbenzoate
methyl phenylacetate
Molecular structure of methyl phenylacetate
2-methylphenyl acetate
Molecular structure of 2-methylphenyl acetate
3-methylphenyl acetate
Molecular structure of 3-methylphenyl acetate
4-methylphenyl acetate
Molecular structure of 4-methylphenyl acetate
(2-methylphenyl)acetic acid
Molecular structure of (2-methylphenyl)acetic acid
2-(3-methylphenyl)acetic acid
Molecular structure of 2-(3-methylphenyl)acetic acid
2-(4-methylphenyl)acetic acid
Molecular structure of 2-(4-methylphenyl)acetic acid
4-methylphenylacetic acid
Molecular structure of 4-methylphenylacetic acid
(1R,2R,5S,6S)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one
Molecular structure of (1R,2R,5S,6S)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one
2-(phenoxymethyl)oxirane
Molecular structure of 2-(phenoxymethyl)oxirane
1-(phenoxy)propan-2-one
Molecular structure of 1-(phenoxy)propan-2-one
2-phenoxypropionaldehyde
Molecular structure of 2-phenoxypropionaldehyde
4-phenyl-1,3-dioxolane
Molecular structure of 4-phenyl-1,3-dioxolane
2-phenylethyl formate
Molecular structure of 2-phenylethyl formate
(2S,3S)-3-phenylglycidol
Molecular structure of (2S,3S)-3-phenylglycidol
(3-phenyloxiranyl)methanol
Molecular structure of (3-phenyloxiranyl)methanol
phenyl propanoate
Molecular structure of phenyl propanoate
2-phenylpropanoic acid
Molecular structure of 2-phenylpropanoic acid
(R)-(-)-2-phenylpropionic acid
Molecular structure of (R)-(-)-2-phenylpropionic acid
(S)-(+)-2-phenylpropionic acid
Molecular structure of (S)-(+)-2-phenylpropionic acid
3-phenylpropionic acid
Molecular structure of 3-phenylpropionic acid
4-[(E)-prop-1-enyl]benzene-1,2-diol
Molecular structure of 4-[(E)-prop-1-enyl]benzene-1,2-diol
4-prop-2-enylbenzene-1,2-diol
Molecular structure of 4-prop-2-enylbenzene-1,2-diol
2,3,6-trimethyl-p-benzoquinone
Molecular structure of 2,3,6-trimethyl-p-benzoquinone