3,7-dihydro-1,3,8-trimethyl-1H-purine-2,6-dione


3,7-dihydro-1,3,8-trimethyl-1H-purine-2,6-dione; 1,3,8-trimethyl-7H-purine-2,6-dione
Formula:C8H10N4O2; 194.19 g/mol
InChiKey:WZBKGWBHAPBSBF-UHFFFAOYSA-N
SMILES:CN1C(=O)N(C)c2nc(C)[nH]c2C1=O
Molecular structure of 3,7-dihydro-1,3,8-trimethyl-1H-purine-2,6-dione

Isomers

benzene-1,4-dicarbohydrazide
Molecular structure of benzene-1,4-dicarbohydrazide
caffeine
Molecular structure of caffeine
3,7-dihydro-1,3,8-trimethyl-1H-purine-2,6-dione
Molecular structure of 3,7-dihydro-1,3,8-trimethyl-1H-purine-2,6-dione
enprofylline
Molecular structure of enprofylline