3-methylenecyclobutanecarbonitrile


3-methylenecyclobutanecarbonitrile
CAS:[15760-35-7]
Formula:C6H7N; 93.13 g/mol
InChiKey:ZRWMAMOBIQQJSA-UHFFFAOYSA-N
SMILES:[CH2]=[C]1C[CH](C1)C#N
Molecular structure of 3-methylenecyclobutanecarbonitrile
Density:0.912 g/mL
Molar volume:102.1 mL/mol

Isomers

aniline
Molecular structure of aniline
cyclopentene-1-carbonitrile
Molecular structure of cyclopentene-1-carbonitrile
dipropargylamine
Molecular structure of dipropargylamine
5-hexynenitrile
Molecular structure of 5-hexynenitrile
3-methylenecyclobutanecarbonitrile
Molecular structure of 3-methylenecyclobutanecarbonitrile
2-methylpyridine
Molecular structure of 2-methylpyridine
3-methylpyridine
Molecular structure of 3-methylpyridine
4-methylpyridine
Molecular structure of 4-methylpyridine