4-benzylbiphenyl


4-benzylbiphenyl; 1-benzyl-4-phenylbenzene; 1-phenyl-4-benzylbenzene
CAS:[613-42-3]
Formula:C19H16; 244.34 g/mol
InChiKey:AGPLQTQFIZBOLI-UHFFFAOYSA-N
SMILES:C(c1ccccc1)c2ccc(cc2)c3ccccc3
Molecular structure of 4-benzylbiphenyl
Density:1.171 g/mL
Molar volume:208.7 mL/mol
Melting point:86 °C

Isomers

4-benzylacenaphthene
Molecular structure of 4-benzylacenaphthene
5-benzylacenaphthene
Molecular structure of 5-benzylacenaphthene
4-benzylbiphenyl
Molecular structure of 4-benzylbiphenyl
2,5-cyclohexadienylidenediphenylmethane
Molecular structure of 2,5-cyclohexadienylidenediphenylmethane
1-methyl-3,5-diphenylbenzene
Molecular structure of 1-methyl-3,5-diphenylbenzene
1-(4-methylphenyl)-1-naphth-2-ylethene
Molecular structure of 1-(4-methylphenyl)-1-naphth-2-ylethene
1-(2-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(2-methylphenyl)-4-phenylbenzene
1-(3-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(3-methylphenyl)-4-phenylbenzene
1-(4-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(4-methylphenyl)-4-phenylbenzene
triphenylmethane
Molecular structure of triphenylmethane