4-bromo-7-hydroxy-1-indanone


4-bromo-7-hydroxy-1-indanone
CAS:[81945-13-3]
Formula:C9H7BrO2; 227.06 g/mol
InChiKey:ZTWBCFVYMDBPPD-UHFFFAOYSA-N
SMILES:Oc1ccc(Br)c2CCC(=O)c12
Molecular structure of 4-bromo-7-hydroxy-1-indanone
Melting point:146 °C

Isomers

6-bromo-4-chromanone
Molecular structure of 6-bromo-4-chromanone
5-[(Z)-2-bromoethenyl]-1,3-benzodioxole
Molecular structure of 5-[(Z)-2-bromoethenyl]-1,3-benzodioxole
4-bromo-7-hydroxy-1-indanone
Molecular structure of 4-bromo-7-hydroxy-1-indanone
2-bromo-5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 2-bromo-5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
4-bromo-5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 4-bromo-5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
(E)-2-bromo-3-phenylprop-2-enoic acid
Molecular structure of (E)-2-bromo-3-phenylprop-2-enoic acid
(Z)-2-bromo-3-phenylprop-2-enoic acid
Molecular structure of (Z)-2-bromo-3-phenylprop-2-enoic acid
(E)-3-(2-bromophenyl)prop-2-enoic acid
Molecular structure of (E)-3-(2-bromophenyl)prop-2-enoic acid
(E)-3-(3-bromophenyl)prop-2-enoic acid
Molecular structure of (E)-3-(3-bromophenyl)prop-2-enoic acid
(E)-3-bromo-3-phenylprop-2-enoic acid
Molecular structure of (E)-3-bromo-3-phenylprop-2-enoic acid
(Z)-3-bromo-3-phenylprop-2-enoic acid
Molecular structure of (Z)-3-bromo-3-phenylprop-2-enoic acid
(E)-3-(4-bromophenyl)-2-propenoic acid
Molecular structure of (E)-3-(4-bromophenyl)-2-propenoic acid