4-methoxyphenylphosphinic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

p-methoxyphenylphosphinic acid; 4-methoxyphenylphosphinic acid
Links:🕷 ChemSpider
Formula:C7H9O3P; 172.12 g/mol
InChiKey:VWEAZVFNLFJJSV-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)[PH](O)=O
Molecular structure of 4-methoxyphenylphosphinic acid

Isomers

benzylphosphonic acid
Molecular structure of benzylphosphonic acid
hydroxymethylphenylphosphinic acid
Molecular structure of hydroxymethylphenylphosphinic acid
4-methoxyphenylphosphinic acid
Molecular structure of 4-methoxyphenylphosphinic acid
(2-methylphenyl)phosphonic acid
Molecular structure of (2-methylphenyl)phosphonic acid
(3-methylphenyl)phosphonic acid
Molecular structure of (3-methylphenyl)phosphonic acid
(4-methylphenyl)phosphonic acid
Molecular structure of (4-methylphenyl)phosphonic acid
  ::     ::   Zla Mavka