4-nitrotoluene


1-methyl-4-nitrobenzene; p-nitrotoluene; 4-nitrotoluene
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[99-99-0]
Formula:C7H7NO2; 137.14 g/mol
InChiKey:ZPTVNYMJQHSSEA-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)[N+]([O-])=O
Molecular structure of 4-nitrotoluene
Odor:weakly bitter almond-like
Density:1.104 g/mL
Molar volume:124.2 mL/mol
Dielectric constant:22.30
Dipole moment:4.40 D
Melting point:54 °C
Boiling point:238 °C
Vapour pressure:0 Torr
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:3.8 atm
Log10 partition octanol / water:3.95

Isomers

3-acetoxypyridine
Molecular structure of 3-acetoxypyridine
2-aminobenzoic acid
Molecular structure of 2-aminobenzoic acid
3-aminobenzoic acid
Molecular structure of 3-aminobenzoic acid
4-aminobenzoic acid
Molecular structure of 4-aminobenzoic acid
benzohydroxamic acid
Molecular structure of benzohydroxamic acid
(E)-benzohydroximic acid
Molecular structure of (E)-benzohydroximic acid
benzyl nitrite
Molecular structure of benzyl nitrite
(E)-2-hydroxybenzaldoxime
Molecular structure of (E)-2-hydroxybenzaldoxime
(E)-3-hydroxybenzaldoxime
Molecular structure of (E)-3-hydroxybenzaldoxime
(E)-4-hydroxybenzaldoxime
Molecular structure of (E)-4-hydroxybenzaldoxime
4-hydroxybenzaldoxime
Molecular structure of 4-hydroxybenzaldoxime
2-hydroxybenzamide
Molecular structure of 2-hydroxybenzamide
3-hydroxybenzamide
Molecular structure of 3-hydroxybenzamide
4-hydroxybenzamide
Molecular structure of 4-hydroxybenzamide
2-methoxy-3-pyridinecarboxaldehyde
Molecular structure of 2-methoxy-3-pyridinecarboxaldehyde
5-methoxy-3-pyridinecarboxaldehyde
Molecular structure of 5-methoxy-3-pyridinecarboxaldehyde
6-methoxy-2-pyridinecarboxaldehyde
Molecular structure of 6-methoxy-2-pyridinecarboxaldehyde
6-methoxypyridine-2-carboxaldehyde
Molecular structure of 6-methoxypyridine-2-carboxaldehyde
6-methoxypyridine-3-carboxaldehyde
Molecular structure of 6-methoxypyridine-3-carboxaldehyde
3,4-(methylenedioxy)aniline
Molecular structure of 3,4-(methylenedioxy)aniline
6-methylnicotinic acid
Molecular structure of 6-methylnicotinic acid
methyl pyridine-2-carboxylate
Molecular structure of methyl pyridine-2-carboxylate
methyl 3-pyridinecarboxylate
Molecular structure of methyl 3-pyridinecarboxylate
methyl pyridine-4-carboxylate
Molecular structure of methyl pyridine-4-carboxylate
2-methylpyridine-3-carboxylic acid
Molecular structure of 2-methylpyridine-3-carboxylic acid
2-methylpyridine-4-carboxylic acid
Molecular structure of 2-methylpyridine-4-carboxylic acid
3-methylpyridine-2-carboxylic acid
Molecular structure of 3-methylpyridine-2-carboxylic acid
4-methylpyridine-2-carboxylic acid
Molecular structure of 4-methylpyridine-2-carboxylic acid
5-methylpyridine-3-carboxylic acid
Molecular structure of 5-methylpyridine-3-carboxylic acid
6-methylpyridine-2-carboxylic acid
Molecular structure of 6-methylpyridine-2-carboxylic acid
nitromethylbenzene
Molecular structure of nitromethylbenzene
2-nitrotoluene
Molecular structure of 2-nitrotoluene
3-nitrotoluene
Molecular structure of 3-nitrotoluene
4-nitrotoluene
Molecular structure of 4-nitrotoluene
phenyl carbamate
Molecular structure of phenyl carbamate
2-pyridin-3-ylacetic acid
Molecular structure of 2-pyridin-3-ylacetic acid
salicylaldoxime
Molecular structure of salicylaldoxime
trigonelline
Molecular structure of trigonelline