4-pyridinecarboxaldehyde N-oxide


4-pyridinecarboxaldehyde N-oxide
CAS:[7216-42-4]
Formula:C6H5NO2; 123.11 g/mol
InChiKey:ZAZQKVZJRMHPQP-UHFFFAOYSA-N
SMILES:[O-][n+]1ccc(C=O)cc1
Molecular structure of 4-pyridinecarboxaldehyde N-oxide
Melting point:151 °C

Isomers

4-hydroxyimino-2,5-cyclohexadien-1-one
Molecular structure of 4-hydroxyimino-2,5-cyclohexadien-1-one
nitrobenzene
Molecular structure of nitrobenzene
4-nitrosophenol
Molecular structure of 4-nitrosophenol
4-pyridinecarboxaldehyde N-oxide
Molecular structure of 4-pyridinecarboxaldehyde N-oxide
pyridine-2-carboxylic acid
Molecular structure of pyridine-2-carboxylic acid
3-pyridinecarboxylic acid
Molecular structure of 3-pyridinecarboxylic acid
4-pyridinecarboxylic acid
Molecular structure of 4-pyridinecarboxylic acid