6-O-a-D-glucopyranosyl-D-glucose


6-O-α-D-glucopyranosyl-D-glucose; isomaltose
Links:📖 PubMed
CAS:[499-40-1]
Formula:C12H22O11; 342.30 g/mol
InChiKey:DLRVVLDZNNYCBX-RTPHMHGBSA-N
SMILES:OC[C@H]1O[C@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
Molecular structure of 6-O-a-D-glucopyranosyl-D-glucose

Isomers

α,a-trehalose
Molecular structure of a,a-trehalose
β,b-trehalose
Molecular structure of b,b-trehalose
cellobiose
Molecular structure of cellobiose
β-cellobiose
Molecular structure of b-cellobiose
gentiobiose
Molecular structure of gentiobiose
2-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 2-O-a-D-glucopyranosyl-D-glucose
3-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 3-O-a-D-glucopyranosyl-D-glucose
4-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 4-O-a-D-glucopyranosyl-D-glucose
6-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 6-O-a-D-glucopyranosyl-D-glucose
lactose
Molecular structure of lactose
β-lactose
Molecular structure of b-lactose
lactulose
Molecular structure of lactulose
laminaribiose
Molecular structure of laminaribiose
α-maltose
Molecular structure of a-maltose
β-maltose
Molecular structure of b-maltose
sophorose
Molecular structure of sophorose
sucrose
Molecular structure of sucrose
α,β-trehalose
Molecular structure of a,b-trehalose