6-chloro-4-chromanone


6-chloro-4-chromanone
CAS:[37674-72-9]
Formula:C9H7ClO2; 182.61 g/mol
InChiKey:LLTDYHFVIVSQPJ-UHFFFAOYSA-N
SMILES:Clc1ccc2OCCC(=O)c2c1
Molecular structure of 6-chloro-4-chromanone
Melting point:100 °C

Isomers

6-chloro-4-chromanone
Molecular structure of 6-chloro-4-chromanone
6-chlorochroman-4-one
Molecular structure of 6-chlorochroman-4-one
5-chloro-5,6-dihydrocyclobuta[f][1,3]benzodioxole
Molecular structure of 5-chloro-5,6-dihydrocyclobuta[f][1,3]benzodioxole
(E)-2-chloro-3-phenylprop-2-enoic acid
Molecular structure of (E)-2-chloro-3-phenylprop-2-enoic acid
(2E)-3-(2-chlorophenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(2-chlorophenyl)prop-2-enoic acid
trans-3-(2-chlorophenyl)-2-propenoic acid
Molecular structure of trans-3-(2-chlorophenyl)-2-propenoic acid
(2E)-3-(3-chlorophenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(3-chlorophenyl)prop-2-enoic acid
(E)-3-chloro-3-phenylprop-2-enoic acid
Molecular structure of (E)-3-chloro-3-phenylprop-2-enoic acid
(Z)-3-chloro-3-phenylprop-2-enoic acid
Molecular structure of (Z)-3-chloro-3-phenylprop-2-enoic acid
(2E)-3-(4-chlorophenyl)prop-2-enoic acid
Molecular structure of (2E)-3-(4-chlorophenyl)prop-2-enoic acid