6-hydroxy-3,4-dihydro-2(1H)-quinolinone


6-hydroxy-3,4-dihydro-2(1~H)-quinolinone
CAS:[54197-66-9]
Formula:C9H9NO2; 163.18 g/mol
InChiKey:HOSGXJWQVBHGLT-UHFFFAOYSA-N
SMILES:Oc1ccc2NC(=O)CCc2c1
Molecular structure of 6-hydroxy-3,4-dihydro-2(1H)-quinolinone
Melting point:238 °C

Isomers

4-acetamidobenzaldehyde
Molecular structure of 4-acetamidobenzaldehyde
2-acetylbenzamide
Molecular structure of 2-acetylbenzamide
N-(4-acetylphenyl)formamide
Molecular structure of N-(4-acetylphenyl)formamide
allyl picolinate
Molecular structure of allyl picolinate
allyl pyridine-3-carboxylate
Molecular structure of allyl pyridine-3-carboxylate
6-amino-3-methyl-1(3~H)-isobenzofuranone
Molecular structure of 6-amino-3-methyl-1(3H)-isobenzofuranone
(E)-3-(2-aminophenyl)prop-2-enoic acid
Molecular structure of (E)-3-(2-aminophenyl)prop-2-enoic acid
(E)-3-(4-aminophenyl)-2-propenoic acid
Molecular structure of (E)-3-(4-aminophenyl)-2-propenoic acid
2,6-diacetylpyridine
Molecular structure of 2,6-diacetylpyridine
3,4-dihydro-5-hydroxy-1(2~H)-isoquinolinone
Molecular structure of 3,4-dihydro-5-hydroxy-1(2H)-isoquinolinone
(2S)-2,3-dihydro-1H-indole-2-carboxylic acid
Molecular structure of (2S)-2,3-dihydro-1H-indole-2-carboxylic acid
2,4-dihydroxy-3,4-dihydroquinoline
Molecular structure of 2,4-dihydroxy-3,4-dihydroquinoline
2,3-dimethoxybenzonitrile
Molecular structure of 2,3-dimethoxybenzonitrile
2,4-dimethoxybenzonitrile
Molecular structure of 2,4-dimethoxybenzonitrile
2,5-dimethoxybenzonitrile
Molecular structure of 2,5-dimethoxybenzonitrile
2,6-dimethoxybenzonitrile
Molecular structure of 2,6-dimethoxybenzonitrile
3,4-dimethoxybenzonitrile
Molecular structure of 3,4-dimethoxybenzonitrile
3,5-dimethoxybenzonitrile
Molecular structure of 3,5-dimethoxybenzonitrile
2-ethoxy-1,3-benzoxazole
Molecular structure of 2-ethoxy-1,3-benzoxazole
2-ethoxyphenyl isocyanate
Molecular structure of 2-ethoxyphenyl isocyanate
4-ethoxyphenyl isocyanate
Molecular structure of 4-ethoxyphenyl isocyanate
6-hydroxy-3,4-dihydro-2(1~H)-quinolinone
Molecular structure of 6-hydroxy-3,4-dihydro-2(1H)-quinolinone
7-hydroxy-3,4-dihydro-2(1~H)-quinolinone
Molecular structure of 7-hydroxy-3,4-dihydro-2(1H)-quinolinone
(1E)-1-hydroxyimino-1-phenylpropan-2-one
Molecular structure of (1E)-1-hydroxyimino-1-phenylpropan-2-one
(2E)-2-hydroxyimino-1-phenylpropan-1-one
Molecular structure of (2E)-2-hydroxyimino-1-phenylpropan-1-one
(R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile
Molecular structure of (R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile
2-(4-hydroxy-3-methoxyphenyl)acetonitrile
Molecular structure of 2-(4-hydroxy-3-methoxyphenyl)acetonitrile
3-hydroxy-2-methylisoindolin-1-one
Molecular structure of 3-hydroxy-2-methylisoindolin-1-one
indoline-2-carboxylic acid
Molecular structure of indoline-2-carboxylic acid
2-methoxybenzyl isocyanate
Molecular structure of 2-methoxybenzyl isocyanate
4-methoxybenzyl isocyanate
Molecular structure of 4-methoxybenzyl isocyanate
2-methoxy-5-methylphenyl isocyanate
Molecular structure of 2-methoxy-5-methylphenyl isocyanate
4-methoxy-2-methylphenyl isocyanate
Molecular structure of 4-methoxy-2-methylphenyl isocyanate
4-methoxyphenoxyacetonitrile
Molecular structure of 4-methoxyphenoxyacetonitrile
4-methyl-2H-1,4-benzoxazin-3(4~H)-one
Molecular structure of 4-methyl-2H-1,4-benzoxazin-3(4H)-one
6-methyl-2H-1,4-benzoxazin-3(4~H)-one
Molecular structure of 6-methyl-2H-1,4-benzoxazin-3(4H)-one
1-methyl-2-[(E)-2-nitroethenyl]benzene
Molecular structure of 1-methyl-2-[(E)-2-nitroethenyl]benzene
1-methyl-4-[(E)-2-nitroethenyl]benzene
Molecular structure of 1-methyl-4-[(E)-2-nitroethenyl]benzene
(2E)-3-(4-methylpyridin-3-yl)prop-2-enoic acid
Molecular structure of (2E)-3-(4-methylpyridin-3-yl)prop-2-enoic acid
[(E)-2-nitroprop-1-enyl]benzene
Molecular structure of [(E)-2-nitroprop-1-enyl]benzene
[(1Z)-2-nitro-1-propen-1-yl]benzene
Molecular structure of [(1Z)-2-nitro-1-propen-1-yl]benzene
2-oxo-N-phenylpropanamide
Molecular structure of 2-oxo-N-phenylpropanamide
3-phenyl-2-oxazolidinone
Molecular structure of 3-phenyl-2-oxazolidinone
(R)-(-)-4-phenyl-2-oxazolidinone
Molecular structure of (R)-(-)-4-phenyl-2-oxazolidinone
(S)-4-phenyl-2-oxazolidinone
Molecular structure of (S)-4-phenyl-2-oxazolidinone
1-phenyl-1,2-propanedione 2-oxime
Molecular structure of 1-phenyl-1,2-propanedione 2-oxime
1-pyridin-3-ylbutane-1,3-dione
Molecular structure of 1-pyridin-3-ylbutane-1,3-dione
quinoline N-oxide hydrate
Molecular structure of quinoline N-oxide hydrate