N-Boc-piperidine-2-methanol


N-Boc-piperidine-2-methanol
CAS:[157634-00-9]
Formula:C11H21NO3; 215.29 g/mol
InChiKey:PZTAGFCBNDBBFZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCCC1CO
Molecular structure of N-Boc-piperidine-2-methanol
Melting point:76 °C

Isomers

N-Boc-piperidine-2-methanol
Molecular structure of N-Boc-piperidine-2-methanol
tert-butyl 4-(hydroxymethyl)piperidine-1-carboxylate
Molecular structure of tert-butyl 4-(hydroxymethyl)piperidine-1-carboxylate
(2S)-2-(2,2-dimethylpropanamido)-4-methylpentanoic acid
Molecular structure of (2S)-2-(2,2-dimethylpropanamido)-4-methylpentanoic acid
ethyl 2-propylpentanoylcarbamate
Molecular structure of ethyl 2-propylpentanoylcarbamate