N-carbethoxyphthalimide


N-carbethoxyphthalimide; 2-(ethoxycarbonyl)isoindole-1,3-dione; N-(ethoxycarbonyl)phthalimide; ethyl 1,3-dioxo-1,3-dihydro-2H-isoindole-2-carboxylate; ethyl 1,3-dioxoisoindole-2-carboxylate
Links:📏 NIST, 🕷 ChemSpider
CAS:[22509-74-6]
Formula:C11H9NO4; 219.20 g/mol
InChiKey:VRHAQNTWKSVEEC-UHFFFAOYSA-N
SMILES:CCOC(=O)N1C(=O)c2ccccc2C1=O
Molecular structure of N-carbethoxyphthalimide
Melting point:81 °C

Isomers

N-(benzoyloxy)succinimide
Molecular structure of N-(benzoyloxy)succinimide
N-carbethoxyphthalimide
Molecular structure of N-carbethoxyphthalimide
3-carbomethoxy-1,2,3,4-tetrahydroisoquinoline-1,4-dione
Molecular structure of 3-carbomethoxy-1,2,3,4-tetrahydroisoquinoline-1,4-dione
4-cyano-6,7-dimethoxy-3H-2-benzofuran-1-one
Molecular structure of 4-cyano-6,7-dimethoxy-3H-2-benzofuran-1-one
(1,3-dioxoisoindolin-2-yl)methyl acetate
Molecular structure of (1,3-dioxoisoindolin-2-yl)methyl acetate
divinyl pyridine-2,5-dicarboxylate
Molecular structure of divinyl pyridine-2,5-dicarboxylate
divinyl pyridine-2,6-dicarboxylate
Molecular structure of divinyl pyridine-2,6-dicarboxylate
divinyl pyridine-3,5-dicarboxylate
Molecular structure of divinyl pyridine-3,5-dicarboxylate
5-(4-methoxyphenyl)isoxazole-3-carboxylic acid
Molecular structure of 5-(4-methoxyphenyl)isoxazole-3-carboxylic acid
3-phthalimidopropanoic acid
Molecular structure of 3-phthalimidopropanoic acid
2-phthalimidopropionic acid
Molecular structure of 2-phthalimidopropionic acid