ambrosin


ambrosin; 6,9α-dimethyl-3-methylidene-3α,4,5,6,6α,9β-hexahydroazuleno[7,8-δ]furan-2,9-dione
Links:📖 PubMed
Formula:C15H18O3; 246.31 g/mol
InChiKey:IFXGCKRDLITNAU-UHFFFAOYSA-N
SMILES:CC1CCC2C(OC(=O)C2=C)C3(C)C1C=CC3=O
Molecular structure of ambrosin
Melting point:146 °C
Log10 partition octanol / water:1.03

Isomers

ambrosin
Molecular structure of ambrosin
irofulven
Molecular structure of irofulven
loxoprofen
Molecular structure of loxoprofen
santonin
Molecular structure of santonin