benzylcyclopentane


benzylcyclopentane; cyclopentylmethylbenzene
CAS:[4410-78-0]
Formula:C12H16; 160.26 g/mol
InChiKey:WAAUXNSLVPBVRA-UHFFFAOYSA-N
SMILES:C1CCC(C1)Cc2ccccc2
Molecular structure of benzylcyclopentane
Density:0.942 g/mL
Molar volume:170.2 mL/mol
Refractive index:1.525
Molecular refractive power:52.11 mL/mol
Boiling point:234 °C

Isomers

1-allyl-4-isopropylbenzene
Molecular structure of 1-allyl-4-isopropylbenzene
benzylcyclopentane
Molecular structure of benzylcyclopentane
4-tert-butylstyrene
Molecular structure of 4-tert-butylstyrene
cyclohexylbenzene
Molecular structure of cyclohexylbenzene
(E)-1-(3,4-dimethylphenyl)-1-butene
Molecular structure of (E)-1-(3,4-dimethylphenyl)-1-butene
2,3-dimethyl-1-phenyl-2-butene
Molecular structure of 2,3-dimethyl-1-phenyl-2-butene
(E)-2-(3,4-dimethylphenyl)-2-butene
Molecular structure of (E)-2-(3,4-dimethylphenyl)-2-butene
(E)-(2,4-dimethylphenyl)-1-butene
Molecular structure of (E)-(2,4-dimethylphenyl)-1-butene
1,1-dimethyl-3-phenylcyclobutane
Molecular structure of 1,1-dimethyl-3-phenylcyclobutane
1,1-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 1,1-dimethyl-1,2,3,4-tetrahydronaphthalene
2,2-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 2,2-dimethyl-1,2,3,4-tetrahydronaphthalene
2,6-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 2,6-dimethyl-1,2,3,4-tetrahydronaphthalene
2,7-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 2,7-dimethyl-1,2,3,4-tetrahydronaphthalene
5,7-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 5,7-dimethyl-1,2,3,4-tetrahydronaphthalene
5,8-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 5,8-dimethyl-1,2,3,4-tetrahydronaphthalene
6,7-dimethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 6,7-dimethyl-1,2,3,4-tetrahydronaphthalene
1,5-dimethyltetralin
Molecular structure of 1,5-dimethyltetralin
2-ethenyl-1,4-diethylbenzene
Molecular structure of 2-ethenyl-1,4-diethylbenzene
1-ethyl-1-methylindane
Molecular structure of 1-ethyl-1-methylindane
1-ethyl-2-methyl-1-phenyl-1-propene
Molecular structure of 1-ethyl-2-methyl-1-phenyl-1-propene
(E)-1-(4-ethylphenyl)-1-butene
Molecular structure of (E)-1-(4-ethylphenyl)-1-butene
2-ethyl-1-phenyl-1-butene
Molecular structure of 2-ethyl-1-phenyl-1-butene
1-ethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 1-ethyl-1,2,3,4-tetrahydronaphthalene
2-ethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 2-ethyl-1,2,3,4-tetrahydronaphthalene
5-ethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 5-ethyl-1,2,3,4-tetrahydronaphthalene
6-ethyl-1,2,3,4-tetrahydronaphthalene
Molecular structure of 6-ethyl-1,2,3,4-tetrahydronaphthalene
hex-5-enylbenzene
Molecular structure of hex-5-enylbenzene
1-isopropenyl-4-isopropylbenzene
Molecular structure of 1-isopropenyl-4-isopropylbenzene
1-isopropylindane
Molecular structure of 1-isopropylindane
1-isopropyl-4-[(E)-prop-1-enyl]benzene
Molecular structure of 1-isopropyl-4-[(E)-prop-1-enyl]benzene
1-methyl-3-cyclopentylbenzene
Molecular structure of 1-methyl-3-cyclopentylbenzene
2-methyl-1-(2,4-dimethylphenyl)propene
Molecular structure of 2-methyl-1-(2,4-dimethylphenyl)propene
(E)-3-methyl-1-(4-methylphenyl)-1-butene
Molecular structure of (E)-3-methyl-1-(4-methylphenyl)-1-butene
3-methyl-2-(4-methylphenyl)-1-butene
Molecular structure of 3-methyl-2-(4-methylphenyl)-1-butene
1-methyl-1-phenylcyclopentane
Molecular structure of 1-methyl-1-phenylcyclopentane
(E)-1-(4-methylphenyl)-1-pentene
Molecular structure of (E)-1-(4-methylphenyl)-1-pentene
2-methyl-3-phenyl-2-pentene
Molecular structure of 2-methyl-3-phenyl-2-pentene
2-methyl-4-phenyl-2-pentene
Molecular structure of 2-methyl-4-phenyl-2-pentene
2-methyl-5-phenyl-2-pentene
Molecular structure of 2-methyl-5-phenyl-2-pentene
4-methyl-4-phenyl-1-pentene
Molecular structure of 4-methyl-4-phenyl-1-pentene
3-methyl-2-p-tolyl-1-butene
Molecular structure of 3-methyl-2-p-tolyl-1-butene
2-phenyl-3,3-dimethyl-1-butene
Molecular structure of 2-phenyl-3,3-dimethyl-1-butene
(E)-1-phenyl-1-hexene
Molecular structure of (E)-1-phenyl-1-hexene
(E)-1-phenyl-2-hexene
Molecular structure of (E)-1-phenyl-2-hexene
(E)-1-phenyl-3-hexene
Molecular structure of (E)-1-phenyl-3-hexene
2-phenyl-2-hexene
Molecular structure of 2-phenyl-2-hexene
3-phenyl-3-hexene
Molecular structure of 3-phenyl-3-hexene
(E)-1-phenyl-3-methyl-1-pentene
Molecular structure of (E)-1-phenyl-3-methyl-1-pentene
2,3,4,5-tetramethylbicyclo[4.2.0]octa-1,3,5-triene
Molecular structure of 2,3,4,5-tetramethylbicyclo[4.2.0]octa-1,3,5-triene
1,1,2-trimethylindane
Molecular structure of 1,1,2-trimethylindane
1,5,7-trimethylindane
Molecular structure of 1,5,7-trimethylindane
(E)-1-(2,4,6-trimethylphenyl)propene
Molecular structure of (E)-1-(2,4,6-trimethylphenyl)propene
1-vinyl-3-sec-butylbenzene
Molecular structure of 1-vinyl-3-sec-butylbenzene
1-vinyl-3-tert-butylbenzene
Molecular structure of 1-vinyl-3-tert-butylbenzene
1-vinyl-4-butylbenzene
Molecular structure of 1-vinyl-4-butylbenzene
1-vinyl-4-sec-butylbenzene
Molecular structure of 1-vinyl-4-sec-butylbenzene
1-vinyl-3,5-diethylbenzene
Molecular structure of 1-vinyl-3,5-diethylbenzene