benzylphosphonic acid


benzylphosphonic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[6881-57-8]
Formula:C7H9O3P; 172.12 g/mol
InChiKey:OGBVRMYSNSKIEF-UHFFFAOYSA-N
SMILES:O[P](O)(=O)Cc1ccccc1
Molecular structure of benzylphosphonic acid
Melting point:169 °C

Isomers

benzylphosphonic acid
Molecular structure of benzylphosphonic acid
hydroxymethylphenylphosphinic acid
Molecular structure of hydroxymethylphenylphosphinic acid
4-methoxyphenylphosphinic acid
Molecular structure of 4-methoxyphenylphosphinic acid
(2-methylphenyl)phosphonic acid
Molecular structure of (2-methylphenyl)phosphonic acid
(3-methylphenyl)phosphonic acid
Molecular structure of (3-methylphenyl)phosphonic acid
(4-methylphenyl)phosphonic acid
Molecular structure of (4-methylphenyl)phosphonic acid