cis-4-cyclopentene-1,3-diol


cis-4-cyclopentene-1,3-diol
CAS:[29783-26-4]
Formula:C5H8O2; 100.12 g/mol
InChiKey:IGRLIBJHDBWKNA-SYDPRGILSA-N
SMILES:O[C@H]1C[C@@H](O)C=C1
Molecular structure of cis-4-cyclopentene-1,3-diol
Melting point:57 °C

Isomers

allyl acetate
Molecular structure of allyl acetate
cyclobutanecarboxylic acid
Molecular structure of cyclobutanecarboxylic acid
cis-4-cyclopentene-1,3-diol
Molecular structure of cis-4-cyclopentene-1,3-diol
cyclopropylacetic acid
Molecular structure of cyclopropylacetic acid
cis-4,7-dihydro-1,3-dioxepin
Molecular structure of cis-4,7-dihydro-1,3-dioxepin
ethyl prop-2-enoate
Molecular structure of ethyl prop-2-enoate
(E)-4-methoxybut-3-en-2-one
Molecular structure of (E)-4-methoxybut-3-en-2-one
methyl (E)-2-butenoate
Molecular structure of methyl (E)-2-butenoate
methyl 3-butenoate
Molecular structure of methyl 3-butenoate
(E)-2-methylbut-2-enoic acid
Molecular structure of (E)-2-methylbut-2-enoic acid
(Z)-2-methylbut-2-enoic acid
Molecular structure of (Z)-2-methylbut-2-enoic acid
2-methyl-3-butenoic acid
Molecular structure of 2-methyl-3-butenoic acid
3-methyl-2-butenoic acid
Molecular structure of 3-methyl-2-butenoic acid
methyl cyclopropanecarboxylate
Molecular structure of methyl cyclopropanecarboxylate
1-methylcyclopropanecarboxylic acid
Molecular structure of 1-methylcyclopropanecarboxylic acid
3-methyl-3-hydroperoxy-1-butyne
Molecular structure of 3-methyl-3-hydroperoxy-1-butyne
2-methylidenebutanoic acid
Molecular structure of 2-methylidenebutanoic acid
methyl 2-methyl-2-propenoate
Molecular structure of methyl 2-methyl-2-propenoate
1-(2-methyloxiranyl)ethanone
Molecular structure of 1-(2-methyloxiranyl)ethanone
3-methyloxolan-2-one
Molecular structure of 3-methyloxolan-2-one
5-methyloxolan-2-one
Molecular structure of 5-methyloxolan-2-one
2-methyltetrahydrofuran-3-one
Molecular structure of 2-methyltetrahydrofuran-3-one
oxan-4-one
Molecular structure of oxan-4-one
4-oxopentanal
Molecular structure of 4-oxopentanal
pentanedial
Molecular structure of pentanedial
2,3-pentanedione
Molecular structure of 2,3-pentanedione
2,4-pentanedione
Molecular structure of 2,4-pentanedione
trans-2-pentenoic acid
Molecular structure of trans-2-pentenoic acid
3-pentenoic acid
Molecular structure of 3-pentenoic acid
4-pentenoic acid
Molecular structure of 4-pentenoic acid
prop-1-en-2-yl acetate
Molecular structure of prop-1-en-2-yl acetate
3-propyloxiran-2-one
Molecular structure of 3-propyloxiran-2-one
tetrahydro-2-furancarbaldehyde
Molecular structure of tetrahydro-2-furancarbaldehyde
tetrahydro-2H-pyran-2-one
Molecular structure of tetrahydro-2H-pyran-2-one
2-vinyl-1,3-dioxolane
Molecular structure of 2-vinyl-1,3-dioxolane
vinyl propionate
Molecular structure of vinyl propionate