anise oil; carvol; (+)-carvone; (S)-(+)-carvone; carvone; δ-carvone; (S)-5-isopropenyl-2-methyl-2-cyclohexenone; (5S)-5-isopropenyl-2-methyl-2-cyclohexen-1-one; δ-6,8(α)-p-menthadien-2-one; p-mentha-6,8-dien-2-one; (5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; (5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
Links: | 🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis |
MeSH: | Antineoplastic Agents |
CAS RN: | [99-49-0] |
Formula: | C10H14O; 150.22 g/mol
|
InChiKey: | ULDHMXUKGWMISQ-VIFPVBQESA-N |
SMILES: | CC(=C)[C@H]1CC=C(C)C(=O)C1 |
![Molecular structure of d-carvone](mol2svg.php?id=2441&w=6&h=6) |
Use: | caraway type liqueur flavors and essences; medicines; toilet soaps |
Density: | 0.961 g/mL |
Molar volume: | 156.3 mL/mol |
Refractive index: | 1.497 |
Molecular refractive power: | 45.74 mL/mol |
Dielectric constant: | 11.00 |
Dipole moment: | 3.17 D |
Melting point: | 89 °C |
Boiling point: | 230 °C |
Log10 partition octanol / water: | 2.71 |