dehydroascorbic acid


dehydroascorbic acid; 5-(1,2-dihydroxyethyl)oxolane-2,3,4-trione
Links:🕷 ChemSpider, 📖 PubMed
MeSH:Growth Substances
CAS:[490-83-5]
Formula:C6H6O6; 174.11 g/mol
InChiKey:SBJKKFFYIZUCET-UHFFFAOYSA-N
SMILES:OCC(O)C1OC(=O)C(=O)C1=O
Molecular structure of dehydroascorbic acid

Isomers

aconitic acid
Molecular structure of aconitic acid
dehydroascorbic acid
Molecular structure of dehydroascorbic acid
(1E)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1E)-1-propene-1,2,3-tricarboxylic acid
(1Z)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1Z)-1-propene-1,2,3-tricarboxylic acid