diphenylethyne


diphenylacetylene; diphenylethyne; 1,1'-ethyne-1,2-diyldibenzene; tolane
CAS:[501-65-5]
Formula:C14H10; 178.23 g/mol
InChiKey:JRXXLCKWQFKACW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C#Cc2ccccc2
Molecular structure of diphenylethyne
Density:0.966 g/mL
Molar volume:184.6 mL/mol
Refractive index:1.606
Molecular refractive power:63.65 mL/mol
Dipole moment:0.00 D
Melting point:61 °C
Boiling point:300 °C
Log10 partition octanol / water:4.78

Isomers

anthracene
Molecular structure of anthracene
1,2-dimethyleneacenaphthene
Molecular structure of 1,2-dimethyleneacenaphthene
diphenylethyne
Molecular structure of diphenylethyne
9-methylenefluorene
Molecular structure of 9-methylenefluorene
phenanthrene
Molecular structure of phenanthrene