exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride


exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
CAS:[6118-51-0]
Formula:C8H6O4; 166.13 g/mol
InChiKey:QQYNRBAAQFZCLF-OIMVXCEXSA-N
SMILES:O=C1OC(=O)[C@@H]2C3OC(C=C3)[C@H]12
Molecular structure of exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
Melting point:118 °C

Isomers

benzene-1,3-dicarboxylic acid
Molecular structure of benzene-1,3-dicarboxylic acid
benzene-1,4-dicarboxylic acid
Molecular structure of benzene-1,4-dicarboxylic acid
2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
Molecular structure of 2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
Molecular structure of exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
3-formyl-2-hydroxybenzoic acid
Molecular structure of 3-formyl-2-hydroxybenzoic acid
3-formyl-4-hydroxybenzoic acid
Molecular structure of 3-formyl-4-hydroxybenzoic acid
4-formyl-3-hydroxybenzoic acid
Molecular structure of 4-formyl-3-hydroxybenzoic acid
5-formylsalicylic acid
Molecular structure of 5-formylsalicylic acid
3,4-(methylenedioxy)benzoic acid
Molecular structure of 3,4-(methylenedioxy)benzoic acid
phthalic acid
Molecular structure of phthalic acid