forodesine


7-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1,5-dihydropyrrolo[2,3-ε]pyrimidin-4-one; forodesine
CAS:[209799-67-7]
US Adopted Name:forodesine
Formula:C11H14N4O4; 266.26 g/mol
InChiKey:IWKXDMQDITUYRK-KUBHLMPHSA-N
SMILES:OC[C@H]1N[C@H]([C@H](O)[C@@H]1O)c2c[nH]c3C(=O)N=CNc23
Molecular structure of forodesine

Isomers

(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
Molecular structure of (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
doxofylline
Molecular structure of doxofylline
forodesine
Molecular structure of forodesine
7-(propoxycarbonyl)theophylline
Molecular structure of 7-(propoxycarbonyl)theophylline
tubercidin
Molecular structure of tubercidin
valeraldehyde-2,4-dinitrophenylhydrazone
Molecular structure of valeraldehyde-2,4-dinitrophenylhydrazone