indigo


2,2'-bi(2,3-dihydroxy-3-oxoindolylidene); C.I. 73000; D&C blue 6; 2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one; indigo; (2E)-2-(3-oxo-1H-indol-2-ylidene)-1H-indol-3-one; 2,3,2',3'-tetrahydro-3,3'-dioxo-2,2'-biindolylidene; vat blue 1
Links:🌍 Wikipedia, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Indigo); p. 84, 90, 130, 143, 219, 228, 603, 612, 695, 733, 1004, 1019, 1040,
CAS:[12626-73-2]
Formula:C16H10N2O2; 262.27 g/mol
InChiKey:COHYTHOBJLSHDF-BUHFOSPRSA-N
SMILES:O=C1C(Nc2ccccc12)=C3Nc4ccccc4C3=O
Molecular structure of indigo
Use:vat dye
Colour:
Melting point:300 °C
1g dissolves in:
714.29g formic acid

Isomers

indigo
Molecular structure of indigo
indirubin
Molecular structure of indirubin